C26H31F3N6O — CID 58809612
[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 58809612) has the molecular formula C26H31F3N6O and a molecular weight of 500.57 g/mol. Its IUPAC name is [4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 58809612 |
| Molecular Formula | C26H31F3N6O |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | [4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CN(C)CCCNc1nc(CN2CCN(C(=O)c3cccc(C(F)(F)F)c3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C26H31F3N6O/c1-33(2)12-6-11-30-24-21-9-3-4-10-22(21)31-23(32-24)18-34-13-15-35(16-14-34)25(36)19-7-5-8-20(17-19)26(27,28)29/h3-5,7-10,17H,6,11-16,18H2,1-2H3,(H,30,31,32) |
| InChIKey | DWSFYILRXFTEMU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|