C25H28ClN7O — CID 143397730
4-[4-[[4-[3-[chloro(methyl)amino]propylamino]quinazolin-2-yl]methyl]piperazine-1-carbonyl]benzonitrile (PubChem CID 143397730) has the molecular formula C25H28ClN7O and a molecular weight of 478.00 g/mol. Its IUPAC name is 4-[4-[[4-[3-[chloro(methyl)amino]propylamino]quinazolin-2-yl]methyl]piperazine-1-carbonyl]benzonitrile.
| Compound Name | 4-[4-[[4-[3-[chloro(methyl)amino]propylamino]quinazolin-2-yl]methyl]piperazine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 143397730 |
| Molecular Formula | C25H28ClN7O |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 4-[4-[[4-[3-[chloro(methyl)amino]propylamino]quinazolin-2-yl]methyl]piperazine-1-carbonyl]benzonitrile |
| SMILES | CN(Cl)CCCNc1nc(CN2CCN(C(=O)c3ccc(C#N)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H28ClN7O/c1-31(26)12-4-11-28-24-21-5-2-3-6-22(21)29-23(30-24)18-32-13-15-33(16-14-32)25(34)20-9-7-19(17-27)8-10-20/h2-3,5-10H,4,11-16,18H2,1H3,(H,28,29,30) |
| InChIKey | HQPYVHNWERQYBB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|