C28H39N7O — CID 15984597
4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-(2,4,6-trimethylphenyl)piperazine-1-carboxamide (PubChem CID 15984597) has the molecular formula C28H39N7O and a molecular weight of 489.67 g/mol. Its IUPAC name is 4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-(2,4,6-trimethylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-(2,4,6-trimethylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 15984597 |
| Molecular Formula | C28H39N7O |
| Molecular Weight | 489.67 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | 4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-(2,4,6-trimethylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)N2CCN(Cc3nc(NCCCN(C)C)c4ccccc4n3)CC2)c(C)c1 |
| InChI | InChI=1S/C28H39N7O/c1-20-17-21(2)26(22(3)18-20)32-28(36)35-15-13-34(14-16-35)19-25-30-24-10-7-6-9-23(24)27(31-25)29-11-8-12-33(4)5/h6-7,9-10,17-18H,8,11-16,19H2,1-5H3,(H,32,36)(H,29,30,31) |
| InChIKey | QIWLBBOSWNOAKW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|