C23H34N6O2 — CID 58808885
[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-(oxolan-3-yl)methanone (PubChem CID 58808885) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is [4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-(oxolan-3-yl)methanone.
| Compound Name | [4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-(oxolan-3-yl)methanone |
|---|---|
| PubChem CID | 58808885 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | [4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-(oxolan-3-yl)methanone |
| SMILES | CN(C)CCCNc1nc(CN2CCN(C(=O)C3CCOC3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H34N6O2/c1-27(2)10-5-9-24-22-19-6-3-4-7-20(19)25-21(26-22)16-28-11-13-29(14-12-28)23(30)18-8-15-31-17-18/h3-4,6-7,18H,5,8-17H2,1-2H3,(H,24,25,26) |
| InChIKey | IWISDQCLODRDKP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|