C23H34N6O3 — CID 58809356
methyl 4-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-4-oxobutanoate (PubChem CID 58809356) has the molecular formula C23H34N6O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is methyl 4-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 58809356 |
| Molecular Formula | C23H34N6O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | methyl 4-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCN(Cc2nc(NCCCN(C)C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C23H34N6O3/c1-27(2)12-6-11-24-23-18-7-4-5-8-19(18)25-20(26-23)17-28-13-15-29(16-14-28)21(30)9-10-22(31)32-3/h4-5,7-8H,6,9-17H2,1-3H3,(H,24,25,26) |
| InChIKey | QASDWKMPVZYOAR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|