C28H39N7O4 — CID 58809774
4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide (PubChem CID 58809774) has the molecular formula C28H39N7O4 and a molecular weight of 537.67 g/mol. Its IUPAC name is 4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58809774 |
| Molecular Formula | C28H39N7O4 |
| Molecular Weight | 537.67 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | 4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCN(Cc3nc(NCCCN(C)C)c4ccccc4n3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C28H39N7O4/c1-33(2)12-8-11-29-27-21-9-6-7-10-22(21)31-25(32-27)19-34-13-15-35(16-14-34)28(36)30-20-17-23(37-3)26(39-5)24(18-20)38-4/h6-7,9-10,17-18H,8,11-16,19H2,1-5H3,(H,30,36)(H,29,31,32) |
| InChIKey | DIKDWZPSNOVMOF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|