C27H37N7O3 — CID 58809357
N-(3,5-dimethoxyphenyl)-4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazine-1-carboxamide (PubChem CID 58809357) has the molecular formula C27H37N7O3 and a molecular weight of 507.64 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazine-1-carboxamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58809357 |
| Molecular Formula | C27H37N7O3 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazine-1-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCN(Cc3nc(NCCCN(C)C)c4ccccc4n3)CC2)cc(OC)c1 |
| InChI | InChI=1S/C27H37N7O3/c1-32(2)11-7-10-28-26-23-8-5-6-9-24(23)30-25(31-26)19-33-12-14-34(15-13-33)27(35)29-20-16-21(36-3)18-22(17-20)37-4/h5-6,8-9,16-18H,7,10-15,19H2,1-4H3,(H,29,35)(H,28,30,31) |
| InChIKey | GZLVTOUGSDZVRB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|