C32H38N6O — CID 58809510
1-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-(4-phenylphenyl)ethanone (PubChem CID 58809510) has the molecular formula C32H38N6O and a molecular weight of 522.70 g/mol. Its IUPAC name is 1-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-(4-phenylphenyl)ethanone.
| Compound Name | 1-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 58809510 |
| Molecular Formula | C32H38N6O |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.31 |
| IUPAC Name | 1-[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]-2-(4-phenylphenyl)ethanone |
| SMILES | CN(C)CCCNc1nc(CN2CCN(C(=O)Cc3ccc(-c4ccccc4)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C32H38N6O/c1-36(2)18-8-17-33-32-28-11-6-7-12-29(28)34-30(35-32)24-37-19-21-38(22-20-37)31(39)23-25-13-15-27(16-14-25)26-9-4-3-5-10-26/h3-7,9-16H,8,17-24H2,1-2H3,(H,33,34,35) |
| InChIKey | GIBVNLLDJQUXDR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|