C25H33BN6 — CID 89386434
CID 89386434 (PubChem CID 89386434) has the molecular formula C25H33BN6 and a molecular weight of 428.39 g/mol.
| Compound Name | CID 89386434 |
|---|---|
| PubChem CID | 89386434 |
| Molecular Formula | C25H33BN6 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | — |
| SMILES | [B]c1ccccc1CN1CCN(Cc2nc(NCCCN(C)C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C25H33BN6/c1-30(2)13-7-12-27-25-21-9-4-6-11-23(21)28-24(29-25)19-32-16-14-31(15-17-32)18-20-8-3-5-10-22(20)26/h3-6,8-11H,7,12-19H2,1-2H3,(H,27,28,29) |
| InChIKey | PCWIJBASOYGIHD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|