C25H33BrN6 — CID 58809721
N-[2-[[4-[(3-bromophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 58809721) has the molecular formula C25H33BrN6 and a molecular weight of 497.49 g/mol. Its IUPAC name is N-[2-[[4-[(3-bromophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[[4-[(3-bromophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 58809721 |
| Molecular Formula | C25H33BrN6 |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[2-[[4-[(3-bromophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(CN2CCN(Cc3cccc(Br)c3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H33BrN6/c1-30(2)12-6-11-27-25-22-9-3-4-10-23(22)28-24(29-25)19-32-15-13-31(14-16-32)18-20-7-5-8-21(26)17-20/h3-5,7-10,17H,6,11-16,18-19H2,1-2H3,(H,27,28,29) |
| InChIKey | KMAYTHJPLOZRIK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|