C26H33N7 — CID 58809483
3-[[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 58809483) has the molecular formula C26H33N7 and a molecular weight of 443.60 g/mol. Its IUPAC name is 3-[[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 58809483 |
| Molecular Formula | C26H33N7 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 3-[[4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | CN(C)CCCNc1nc(CN2CCN(Cc3cccc(C#N)c3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C26H33N7/c1-31(2)12-6-11-28-26-23-9-3-4-10-24(23)29-25(30-26)20-33-15-13-32(14-16-33)19-22-8-5-7-21(17-22)18-27/h3-5,7-10,17H,6,11-16,19-20H2,1-2H3,(H,28,29,30) |
| InChIKey | BEQWLILFQLRIQN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|