C23H26N6O — CID 58797483
3-cyano-N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methylbenzamide (PubChem CID 58797483) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-cyano-N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methylbenzamide.
| Compound Name | 3-cyano-N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 58797483 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 3-cyano-N-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-N-methylbenzamide |
| SMILES | CN(C)CCCNc1nc(CN(C)C(=O)c2cccc(C#N)c2)nc2ccccc12 |
| InChI | InChI=1S/C23H26N6O/c1-28(2)13-7-12-25-22-19-10-4-5-11-20(19)26-21(27-22)16-29(3)23(30)18-9-6-8-17(14-18)15-24/h4-6,8-11,14H,7,12-13,16H2,1-3H3,(H,25,26,27) |
| InChIKey | XVDIWVCIXLQZCY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|