C20H29N5O3 — CID 58797313
methyl 4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl-methylamino]-4-oxobutanoate (PubChem CID 58797313) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl 4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl-methylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl-methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 58797313 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | methyl 4-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl-methylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N(C)Cc1nc(NCCCN(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C20H29N5O3/c1-24(2)13-7-12-21-20-15-8-5-6-9-16(15)22-17(23-20)14-25(3)18(26)10-11-19(27)28-4/h5-6,8-9H,7,10-14H2,1-4H3,(H,21,22,23) |
| InChIKey | VAAXFCIXFRMHJR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|