C16H23ClN4O2 — CID 20982620
4-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]butanoic acid;hydrochloride (PubChem CID 20982620) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 4-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]butanoic acid;hydrochloride.
| Compound Name | 4-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 20982620 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 4-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]butanoic acid;hydrochloride |
| SMILES | CN(C)CCc1nc(NCCCC(=O)O)c2ccccc2n1.Cl |
| InChI | InChI=1S/C16H22N4O2.ClH/c1-20(2)11-9-14-18-13-7-4-3-6-12(13)16(19-14)17-10-5-8-15(21)22;/h3-4,6-7H,5,8-11H2,1-2H3,(H,21,22)(H,17,18,19);1H |
| InChIKey | CWFOYOJDOHFSFS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|