C15H20N4O3 — CID 1424418
(2R)-2-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]-3-hydroxypropanoic acid (PubChem CID 1424418) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is (2R)-2-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 1424418 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (2R)-2-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]-3-hydroxypropanoic acid |
| SMILES | CN(C)CCc1nc(N[C@H](CO)C(=O)O)c2ccccc2n1 |
| InChI | InChI=1S/C15H20N4O3/c1-19(2)8-7-13-16-11-6-4-3-5-10(11)14(18-13)17-12(9-20)15(21)22/h3-6,12,20H,7-9H2,1-2H3,(H,21,22)(H,16,17,18)/t12-/m1/s1 |
| InChIKey | KVSTZXYHPWUNBB-GFCCVEGCSA-N |
| XLogP | 0.59 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |