C17H24N4O2S — CID 2061832
(2R)-2-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 2061832) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is (2R)-2-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 2061832 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (2R)-2-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](Nc1nc(CCN(C)C)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H24N4O2S/c1-21(2)10-8-15-18-13-7-5-4-6-12(13)16(20-15)19-14(17(22)23)9-11-24-3/h4-7,14H,8-11H2,1-3H3,(H,22,23)(H,18,19,20)/t14-/m1/s1 |
| InChIKey | JEFDUCADWSRTOG-CQSZACIVSA-N |
| XLogP | 2.35 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |