C19H21ClN4O2 — CID 20982609
4-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]benzoic acid;hydrochloride (PubChem CID 20982609) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 4-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]benzoic acid;hydrochloride.
| Compound Name | 4-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 20982609 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-[[2-[2-(dimethylamino)ethyl]quinazolin-4-yl]amino]benzoic acid;hydrochloride |
| SMILES | CN(C)CCc1nc(Nc2ccc(C(=O)O)cc2)c2ccccc2n1.Cl |
| InChI | InChI=1S/C19H20N4O2.ClH/c1-23(2)12-11-17-21-16-6-4-3-5-15(16)18(22-17)20-14-9-7-13(8-10-14)19(24)25;/h3-10H,11-12H2,1-2H3,(H,24,25)(H,20,21,22);1H |
| InChIKey | UCDJHWWRQOJHKZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |