C24H32N6O — CID 21004036
N-[2-(diethylamino)ethyl]-4-[[2-[(dimethylamino)methyl]quinazolin-4-yl]amino]benzamide (PubChem CID 21004036) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-4-[[2-[(dimethylamino)methyl]quinazolin-4-yl]amino]benzamide.
| Compound Name | N-[2-(diethylamino)ethyl]-4-[[2-[(dimethylamino)methyl]quinazolin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 21004036 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-4-[[2-[(dimethylamino)methyl]quinazolin-4-yl]amino]benzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(Nc2nc(CN(C)C)nc3ccccc23)cc1 |
| InChI | InChI=1S/C24H32N6O/c1-5-30(6-2)16-15-25-24(31)18-11-13-19(14-12-18)26-23-20-9-7-8-10-21(20)27-22(28-23)17-29(3)4/h7-14H,5-6,15-17H2,1-4H3,(H,25,31)(H,26,27,28) |
| InChIKey | XOJOWTPXOKJOPU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |