C18H19N3O — CID 10756141
N-(4-methoxyphenyl)-2-propylquinazolin-4-amine (PubChem CID 10756141) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-propylquinazolin-4-amine.
| Compound Name | N-(4-methoxyphenyl)-2-propylquinazolin-4-amine |
|---|---|
| PubChem CID | 10756141 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-(4-methoxyphenyl)-2-propylquinazolin-4-amine |
| SMILES | CCCc1nc(Nc2ccc(OC)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C18H19N3O/c1-3-6-17-20-16-8-5-4-7-15(16)18(21-17)19-13-9-11-14(22-2)12-10-13/h4-5,7-12H,3,6H2,1-2H3,(H,19,20,21) |
| InChIKey | UICPNMFRRMWQRS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |