C14H21N5 — CID 143396865
N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 143396865) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 143396865 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CN(C)Cc1nc(NCCCN)c2ccccc2n1 |
| InChI | InChI=1S/C14H21N5/c1-19(2)10-13-17-12-7-4-3-6-11(12)14(18-13)16-9-5-8-15/h3-4,6-7H,5,8-10,15H2,1-2H3,(H,16,17,18) |
| InChIKey | LTFPLINCNWEURO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|