C20H31N5S — CID 58797369
N',N'-dimethyl-N-[2-[[methyl(thian-4-yl)amino]methyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 58797369) has the molecular formula C20H31N5S and a molecular weight of 373.57 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[[methyl(thian-4-yl)amino]methyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[[methyl(thian-4-yl)amino]methyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 58797369 |
| Molecular Formula | C20H31N5S |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | N',N'-dimethyl-N-[2-[[methyl(thian-4-yl)amino]methyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(CN(C)C2CCSCC2)nc2ccccc12 |
| InChI | InChI=1S/C20H31N5S/c1-24(2)12-6-11-21-20-17-7-4-5-8-18(17)22-19(23-20)15-25(3)16-9-13-26-14-10-16/h4-5,7-8,16H,6,9-15H2,1-3H3,(H,21,22,23) |
| InChIKey | XYJGFGPAVOYRCG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|