C32H40N6 — CID 58809144
N-[2-[[4-(2,2-diphenylethyl)piperazin-1-yl]methyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 58809144) has the molecular formula C32H40N6 and a molecular weight of 508.71 g/mol. Its IUPAC name is N-[2-[[4-(2,2-diphenylethyl)piperazin-1-yl]methyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[2-[[4-(2,2-diphenylethyl)piperazin-1-yl]methyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 58809144 |
| Molecular Formula | C32H40N6 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.33 |
| IUPAC Name | N-[2-[[4-(2,2-diphenylethyl)piperazin-1-yl]methyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(CN2CCN(CC(c3ccccc3)c3ccccc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C32H40N6/c1-36(2)19-11-18-33-32-28-16-9-10-17-30(28)34-31(35-32)25-38-22-20-37(21-23-38)24-29(26-12-5-3-6-13-26)27-14-7-4-8-15-27/h3-10,12-17,29H,11,18-25H2,1-2H3,(H,33,34,35) |
| InChIKey | CMASXFYNLLBCLE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|