C27H31N5O — CID 143396543
N-methyl-N'-[2-[[methyl-[(4-phenoxyphenyl)methyl]amino]methyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 143396543) has the molecular formula C27H31N5O and a molecular weight of 441.58 g/mol. Its IUPAC name is N-methyl-N'-[2-[[methyl-[(4-phenoxyphenyl)methyl]amino]methyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N-methyl-N'-[2-[[methyl-[(4-phenoxyphenyl)methyl]amino]methyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 143396543 |
| Molecular Formula | C27H31N5O |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | N-methyl-N'-[2-[[methyl-[(4-phenoxyphenyl)methyl]amino]methyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CNCCCNc1nc(CN(C)Cc2ccc(Oc3ccccc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C27H31N5O/c1-28-17-8-18-29-27-24-11-6-7-12-25(24)30-26(31-27)20-32(2)19-21-13-15-23(16-14-21)33-22-9-4-3-5-10-22/h3-7,9-16,28H,8,17-20H2,1-2H3,(H,29,30,31) |
| InChIKey | QARZODGTSZWMPL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|