C23H29N5O2 — CID 143396614
N'-[2-[[1,3-benzodioxol-4-ylmethyl(methyl)amino]methyl]quinazolin-4-yl]-N-methylbutane-1,4-diamine (PubChem CID 143396614) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N'-[2-[[1,3-benzodioxol-4-ylmethyl(methyl)amino]methyl]quinazolin-4-yl]-N-methylbutane-1,4-diamine.
| Compound Name | N'-[2-[[1,3-benzodioxol-4-ylmethyl(methyl)amino]methyl]quinazolin-4-yl]-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 143396614 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N'-[2-[[1,3-benzodioxol-4-ylmethyl(methyl)amino]methyl]quinazolin-4-yl]-N-methylbutane-1,4-diamine |
| SMILES | CNCCCCNc1nc(CN(C)Cc2cccc3c2OCO3)nc2ccccc12 |
| InChI | InChI=1S/C23H29N5O2/c1-24-12-5-6-13-25-23-18-9-3-4-10-19(18)26-21(27-23)15-28(2)14-17-8-7-11-20-22(17)30-16-29-20/h3-4,7-11,24H,5-6,12-16H2,1-2H3,(H,25,26,27) |
| InChIKey | TWMHWWJRPBYTRV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|