C23H25F3N4O2 — CID 26358926
methyl 4-[[2-[[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]methyl]quinazolin-4-yl]amino]butanoate (PubChem CID 26358926) has the molecular formula C23H25F3N4O2 and a molecular weight of 446.47 g/mol. Its IUPAC name is methyl 4-[[2-[[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]methyl]quinazolin-4-yl]amino]butanoate.
| Compound Name | methyl 4-[[2-[[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]methyl]quinazolin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 26358926 |
| Molecular Formula | C23H25F3N4O2 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | methyl 4-[[2-[[methyl-[[2-(trifluoromethyl)phenyl]methyl]amino]methyl]quinazolin-4-yl]amino]butanoate |
| SMILES | COC(=O)CCCNc1nc(CN(C)Cc2ccccc2C(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C23H25F3N4O2/c1-30(14-16-8-3-5-10-18(16)23(24,25)26)15-20-28-19-11-6-4-9-17(19)22(29-20)27-13-7-12-21(31)32-2/h3-6,8-11H,7,12-15H2,1-2H3,(H,27,28,29) |
| InChIKey | MXXRPVYOTKZKGX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|