C25H35F3N6O — CID 143396648
N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine;ethane;N-[2-(trifluoromethyl)phenyl]formamide (PubChem CID 143396648) has the molecular formula C25H35F3N6O and a molecular weight of 492.59 g/mol. Its IUPAC name is N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine;ethane;N-[2-(trifluoromethyl)phenyl]formamide.
| Compound Name | N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine;ethane;N-[2-(trifluoromethyl)phenyl]formamide |
|---|---|
| PubChem CID | 143396648 |
| Molecular Formula | C25H35F3N6O |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | N'-[2-[(dimethylamino)methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine;ethane;N-[2-(trifluoromethyl)phenyl]formamide |
| SMILES | CC.CNCCCNc1nc(CN(C)C)nc2ccccc12.O=CNc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H23N5.C8H6F3NO.C2H6/c1-16-9-6-10-17-15-12-7-4-5-8-13(12)18-14(19-15)11-20(2)3;9-8(10,11)6-3-1-2-4-7(6)12-5-13;1-2/h4-5,7-8,16H,6,9-11H2,1-3H3,(H,17,18,19);1-5H,(H,12,13);1-2H3 |
| InChIKey | INJAIIZZDDLXGK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|