C25H31F3N6 — CID 143397861
N-methyl-N'-[2-[[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 143397861) has the molecular formula C25H31F3N6 and a molecular weight of 472.56 g/mol. Its IUPAC name is N-methyl-N'-[2-[[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N-methyl-N'-[2-[[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 143397861 |
| Molecular Formula | C25H31F3N6 |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-methyl-N'-[2-[[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CNCCCNc1nc(CN2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H31F3N6/c1-29-11-4-12-30-24-21-5-2-3-6-22(21)31-23(32-24)18-34-15-13-33(14-16-34)17-19-7-9-20(10-8-19)25(26,27)28/h2-3,5-10,29H,4,11-18H2,1H3,(H,30,31,32) |
| InChIKey | KOYHGWPLUXFNSU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|