C30H33F3N6O — CID 143397634
N'-[2-[[4-[phenyl-[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 143397634) has the molecular formula C30H33F3N6O and a molecular weight of 550.63 g/mol. Its IUPAC name is N'-[2-[[4-[phenyl-[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N'-[2-[[4-[phenyl-[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 143397634 |
| Molecular Formula | C30H33F3N6O |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | N'-[2-[[4-[phenyl-[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | NCCCNc1nc(CN2CCN(C(c3ccccc3)c3ccc(OC(F)(F)F)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C30H33F3N6O/c31-30(32,33)40-24-13-11-23(12-14-24)28(22-7-2-1-3-8-22)39-19-17-38(18-20-39)21-27-36-26-10-5-4-9-25(26)29(37-27)35-16-6-15-34/h1-5,7-14,28H,6,15-21,34H2,(H,35,36,37) |
| InChIKey | WDJFQCJPWWELCX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|