C31H35Cl2N5O — CID 58809692
3-[2-[[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 58809692) has the molecular formula C31H35Cl2N5O and a molecular weight of 564.56 g/mol. Its IUPAC name is 3-[2-[[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[2-[[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 58809692 |
| Molecular Formula | C31H35Cl2N5O |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 3-[2-[[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methyl]quinazolin-4-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1nc(CN2CCN(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C31H35Cl2N5O/c1-36(2)16-5-21-39-31-27-6-3-4-7-28(27)34-29(35-31)22-37-17-19-38(20-18-37)30(23-8-12-25(32)13-9-23)24-10-14-26(33)15-11-24/h3-4,6-15,30H,5,16-22H2,1-2H3 |
| InChIKey | JJZKRVFMZVPHAS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|