C32H35Cl2N7 — CID 143397385
2-[[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-N-[3-(4,5-dihydroimidazol-1-yl)propyl]quinazolin-4-amine (PubChem CID 143397385) has the molecular formula C32H35Cl2N7 and a molecular weight of 588.59 g/mol. Its IUPAC name is 2-[[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-N-[3-(4,5-dihydroimidazol-1-yl)propyl]quinazolin-4-amine.
| Compound Name | 2-[[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-N-[3-(4,5-dihydroimidazol-1-yl)propyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 143397385 |
| Molecular Formula | C32H35Cl2N7 |
| Molecular Weight | 588.59 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | 2-[[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methyl]-N-[3-(4,5-dihydroimidazol-1-yl)propyl]quinazolin-4-amine |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2)N2CCN(Cc3nc(NCCCN4C=NCC4)c4ccccc4n3)CC2)cc1 |
| InChI | InChI=1S/C32H35Cl2N7/c33-26-10-6-24(7-11-26)31(25-8-12-27(34)13-9-25)41-20-18-39(19-21-41)22-30-37-29-5-2-1-4-28(29)32(38-30)36-14-3-16-40-17-15-35-23-40/h1-2,4-13,23,31H,3,14-22H2,(H,36,37,38) |
| InChIKey | IGIMHFQYUKTNHN-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|