C25H31F3N6O2S — CID 58809619
N',N'-dimethyl-N-[2-[[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 58809619) has the molecular formula C25H31F3N6O2S and a molecular weight of 536.62 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 58809619 |
| Molecular Formula | C25H31F3N6O2S |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | N',N'-dimethyl-N-[2-[[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CN(C)CCCNc1nc(CN2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H31F3N6O2S/c1-32(2)12-6-11-29-24-21-9-3-4-10-22(21)30-23(31-24)18-33-13-15-34(16-14-33)37(35,36)20-8-5-7-19(17-20)25(26,27)28/h3-5,7-10,17H,6,11-16,18H2,1-2H3,(H,29,30,31) |
| InChIKey | ASUACQMBZNXNSW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|