C22H28ClN5 — CID 143396502
N'-[2-[[(3-chloro-4-methylphenyl)methyl-methylamino]methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine (PubChem CID 143396502) has the molecular formula C22H28ClN5 and a molecular weight of 397.95 g/mol. Its IUPAC name is N'-[2-[[(3-chloro-4-methylphenyl)methyl-methylamino]methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[2-[[(3-chloro-4-methylphenyl)methyl-methylamino]methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143396502 |
| Molecular Formula | C22H28ClN5 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N'-[2-[[(3-chloro-4-methylphenyl)methyl-methylamino]methyl]quinazolin-4-yl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNc1nc(CN(C)Cc2ccc(C)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C22H28ClN5/c1-16-9-10-17(13-19(16)23)14-28(3)15-21-26-20-8-5-4-7-18(20)22(27-21)25-12-6-11-24-2/h4-5,7-10,13,24H,6,11-12,14-15H2,1-3H3,(H,25,26,27) |
| InChIKey | HJAXFTXBFAPRDG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|