C22H27BrN6O — CID 58797439
3-(3-bromophenyl)-1-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-1-methylurea (PubChem CID 58797439) has the molecular formula C22H27BrN6O and a molecular weight of 471.40 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-1-methylurea.
| Compound Name | 3-(3-bromophenyl)-1-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 58797439 |
| Molecular Formula | C22H27BrN6O |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 3-(3-bromophenyl)-1-[[4-[3-(dimethylamino)propylamino]quinazolin-2-yl]methyl]-1-methylurea |
| SMILES | CN(C)CCCNc1nc(CN(C)C(=O)Nc2cccc(Br)c2)nc2ccccc12 |
| InChI | InChI=1S/C22H27BrN6O/c1-28(2)13-7-12-24-21-18-10-4-5-11-19(18)26-20(27-21)15-29(3)22(30)25-17-9-6-8-16(23)14-17/h4-6,8-11,14H,7,12-13,15H2,1-3H3,(H,25,30)(H,24,26,27) |
| InChIKey | LDQVXJKLMVWJOF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|