C15H21ClN4O2 — CID 20982537
4-[4-(dimethylamino)butylamino]quinazoline-5-carboxylic acid;hydrochloride (PubChem CID 20982537) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 4-[4-(dimethylamino)butylamino]quinazoline-5-carboxylic acid;hydrochloride.
| Compound Name | 4-[4-(dimethylamino)butylamino]quinazoline-5-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 20982537 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-[4-(dimethylamino)butylamino]quinazoline-5-carboxylic acid;hydrochloride |
| SMILES | CN(C)CCCCNc1ncnc2cccc(C(=O)O)c12.Cl |
| InChI | InChI=1S/C15H20N4O2.ClH/c1-19(2)9-4-3-8-16-14-13-11(15(20)21)6-5-7-12(13)17-10-18-14;/h5-7,10H,3-4,8-9H2,1-2H3,(H,20,21)(H,16,17,18);1H |
| InChIKey | VGXVMZMNIHWGAD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|