C16H19N5O2 — CID 21426004
4-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]quinoxaline-3-carboxylic acid (PubChem CID 21426004) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]quinoxaline-3-carboxylic acid.
| Compound Name | 4-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]quinoxaline-3-carboxylic acid |
|---|---|
| PubChem CID | 21426004 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 4-[3-(dimethylamino)propylamino]pyrazolo[1,5-a]quinoxaline-3-carboxylic acid |
| SMILES | CN(C)CCCNc1nc2ccccc2n2ncc(C(=O)O)c12 |
| InChI | InChI=1S/C16H19N5O2/c1-20(2)9-5-8-17-15-14-11(16(22)23)10-18-21(14)13-7-4-3-6-12(13)19-15/h3-4,6-7,10H,5,8-9H2,1-2H3,(H,17,19)(H,22,23) |
| InChIKey | RSRJHGAOJGFJMS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|