C15H18N2O4 — CID 106307515
2-[3-(2-hydroxyethoxy)propylamino]quinoline-3-carboxylic acid (PubChem CID 106307515) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethoxy)propylamino]quinoline-3-carboxylic acid.
| Compound Name | 2-[3-(2-hydroxyethoxy)propylamino]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 106307515 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-[3-(2-hydroxyethoxy)propylamino]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cc2ccccc2nc1NCCCOCCO |
| InChI | InChI=1S/C15H18N2O4/c18-7-9-21-8-3-6-16-14-12(15(19)20)10-11-4-1-2-5-13(11)17-14/h1-2,4-5,10,18H,3,6-9H2,(H,16,17)(H,19,20) |
| InChIKey | OQXRNEACALJTHF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|