C11H15FN2O4 — CID 106305372
5-fluoro-2-[3-(2-hydroxyethoxy)propylamino]pyridine-3-carboxylic acid (PubChem CID 106305372) has the molecular formula C11H15FN2O4 and a molecular weight of 258.25 g/mol. Its IUPAC name is 5-fluoro-2-[3-(2-hydroxyethoxy)propylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-fluoro-2-[3-(2-hydroxyethoxy)propylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 106305372 |
| Molecular Formula | C11H15FN2O4 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 5-fluoro-2-[3-(2-hydroxyethoxy)propylamino]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(F)cnc1NCCCOCCO |
| InChI | InChI=1S/C11H15FN2O4/c12-8-6-9(11(16)17)10(14-7-8)13-2-1-4-18-5-3-15/h6-7,15H,1-5H2,(H,13,14)(H,16,17) |
| InChIKey | BKMCEDQSDOKUDO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|