C12H19N3O4 — CID 114098601
5-amino-2-[3-(2-methoxyethoxy)propylamino]pyridine-3-carboxylic acid (PubChem CID 114098601) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-amino-2-[3-(2-methoxyethoxy)propylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-amino-2-[3-(2-methoxyethoxy)propylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114098601 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 5-amino-2-[3-(2-methoxyethoxy)propylamino]pyridine-3-carboxylic acid |
| SMILES | COCCOCCCNc1ncc(N)cc1C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-18-5-6-19-4-2-3-14-11-10(12(16)17)7-9(13)8-15-11/h7-8H,2-6,13H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | GHHHZKXJQLERNA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|