C13H21N3O2S — CID 114117482
5-amino-2-[(2-ethyl-2-methylsulfanylbutyl)amino]pyridine-3-carboxylic acid (PubChem CID 114117482) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 5-amino-2-[(2-ethyl-2-methylsulfanylbutyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 5-amino-2-[(2-ethyl-2-methylsulfanylbutyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114117482 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 5-amino-2-[(2-ethyl-2-methylsulfanylbutyl)amino]pyridine-3-carboxylic acid |
| SMILES | CCC(CC)(CNc1ncc(N)cc1C(=O)O)SC |
| InChI | InChI=1S/C13H21N3O2S/c1-4-13(5-2,19-3)8-16-11-10(12(17)18)6-9(14)7-15-11/h6-7H,4-5,8,14H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | CSRJWHBJNJHYCG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |