5-amino-2-ethylpyridine-3-carboxylic acid

C8H10N2O2 — CID 84652342

IUPAC5-amino-2-ethylpyridine-3-carboxylic acid
SMILESCCc1ncc(N)cc1C(=O)O
InChIInChI=1S/C8H10N2O2/c1-2-7-6(8(11)12)3-5(9)4-10-7/h3-4H,2,9H2,1H3,(H,11,12)
InChIKeyLRXBVKMBURCAMI-UHFFFAOYSA-N
MW166.18 g/mol
LogP0.92
Rot. Bonds2

About 5-amino-2-ethylpyridine-3-carboxylic acid

5-amino-2-ethylpyridine-3-carboxylic acid (PubChem CID 84652342) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-amino-2-ethylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-amino-2-ethylpyridine-3-carboxylic acid
PubChem CID84652342
Molecular FormulaC8H10N2O2
Molecular Weight166.18 g/mol
Exact Mass166.07
IUPAC Name5-amino-2-ethylpyridine-3-carboxylic acid
SMILESCCc1ncc(N)cc1C(=O)O
InChIInChI=1S/C8H10N2O2/c1-2-7-6(8(11)12)3-5(9)4-10-7/h3-4H,2,9H2,1H3,(H,11,12)
InChIKeyLRXBVKMBURCAMI-UHFFFAOYSA-N
XLogP0.92
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.18
LogP ≤ 50.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 5-amino-2-ethylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-aminopyridine-2,3-dicarboxylic acid
CID 71695342
5-amino-2-(octylamino)pyridine-3-carboxylic acid
CID 114047314
5-amino-2-[(2-ethyl-2-methylsulfanylbutyl)amino]pyridine-3-carboxylic acid
CID 114117482
5-bromo-6-ethylpyridin-3-amine
CID 105453283
6-amino-2-ethylquinoline-3-carboxylic acid
CID 158317833
5-amino-2-[(2-amino-2-oxoethyl)-propan-2-ylamino]pyridine-3-carboxylic acid
CID 114047100
5-amino-2-(2-methylpropylamino)pyridine-3-carboxylic acid
CID 82470655
5-amino-2-[[2-(dimethylamino)-2-oxoethyl]-ethylamino]pyridine-3-carboxylic acid
CID 114047069
5-amino-2-(4-ethoxycarbonylpiperazin-1-yl)pyridine-3-carboxylic acid
CID 98032415
4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid
CID 83908935
5-amino-2-pyrrolidin-1-ylpyridine-3-carboxylic acid
CID 53213917
1-(2-ethyl-5-methyl-3-pyridinyl)ethanone
CID 119089666

Frequently Asked Questions

What is the IUPAC name of 5-amino-2-ethylpyridine-3-carboxylic acid?
The IUPAC name of 5-amino-2-ethylpyridine-3-carboxylic acid (CID 84652342) is 5-amino-2-ethylpyridine-3-carboxylic acid.
What is the SMILES notation for 5-amino-2-ethylpyridine-3-carboxylic acid?
The canonical SMILES for 5-amino-2-ethylpyridine-3-carboxylic acid is CCc1ncc(N)cc1C(=O)O.
What is the InChIKey of 5-amino-2-ethylpyridine-3-carboxylic acid?
The InChIKey is LRXBVKMBURCAMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-2-7-6(8(11)12)3-5(9)4-10-7/h3-4H,2,9H2,1H3,(H,11,12).
What are the key properties of 5-amino-2-ethylpyridine-3-carboxylic acid?
5-amino-2-ethylpyridine-3-carboxylic acid has a molecular weight of 166.18 g/mol, XLogP of 0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-ethylpyridine-3-carboxylic acid is sourced from PubChem (CID 84652342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).