About 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid
4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid (PubChem CID 83908935) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid.
Analyze 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid?
The IUPAC name of 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid (CID 83908935) is 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid.
What is the SMILES notation for 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid?
The canonical SMILES for 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid is CCc1noc2ncc(C(=O)O)c(N)c12.
What is the InChIKey of 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid?
The InChIKey is LKGRZOTYBIKLQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O3/c1-2-5-6-7(10)4(9(13)14)3-11-8(6)15-12-5/h3H,2H2,1H3,(H2,10,11)(H,13,14).
What are the key properties of 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid?
4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid has a molecular weight of 207.19 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-carboxylic acid is sourced from PubChem (CID 83908935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).