2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid

C9H9N3O4 — CID 53213954

IUPAC2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid
SMILESCCc1noc2ncn(CC(=O)O)c(=O)c12
InChIInChI=1S/C9H9N3O4/c1-2-5-7-8(16-11-5)10-4-12(9(7)15)3-6(13)14/h4H,2-3H2,1H3,(H,13,14)
InChIKeyMDKCXVNYQOLIGU-UHFFFAOYSA-N
MW223.19 g/mol
LogP0.03
Rot. Bonds3

About 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid

2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid (PubChem CID 53213954) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid.

Molecular Properties

Compound Name2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid
PubChem CID53213954
Molecular FormulaC9H9N3O4
Molecular Weight223.19 g/mol
Exact Mass223.06
IUPAC Name2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid
SMILESCCc1noc2ncn(CC(=O)O)c(=O)c12
InChIInChI=1S/C9H9N3O4/c1-2-5-7-8(16-11-5)10-4-12(9(7)15)3-6(13)14/h4H,2-3H2,1H3,(H,13,14)
InChIKeyMDKCXVNYQOLIGU-UHFFFAOYSA-N
XLogP0.03
TPSA98.22 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.19
LogP ≤ 50.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid?
The IUPAC name of 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid (CID 53213954) is 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid.
What is the SMILES notation for 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid?
The canonical SMILES for 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid is CCc1noc2ncn(CC(=O)O)c(=O)c12.
What is the InChIKey of 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid?
The InChIKey is MDKCXVNYQOLIGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O4/c1-2-5-7-8(16-11-5)10-4-12(9(7)15)3-6(13)14/h4H,2-3H2,1H3,(H,13,14).
What are the key properties of 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid?
2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid has a molecular weight of 223.19 g/mol, XLogP of 0.03, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid is sourced from PubChem (CID 53213954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).