C7H6N2O4 — CID 71695342
5-aminopyridine-2,3-dicarboxylic acid (PubChem CID 71695342) has the molecular formula C7H6N2O4 and a molecular weight of 182.14 g/mol. Its IUPAC name is 5-aminopyridine-2,3-dicarboxylic acid.
| Compound Name | 5-aminopyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 71695342 |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 5-aminopyridine-2,3-dicarboxylic acid |
| SMILES | Nc1cnc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C7H6N2O4/c8-3-1-4(6(10)11)5(7(12)13)9-2-3/h1-2H,8H2,(H,10,11)(H,12,13) |
| InChIKey | WVDZHPOUZQHFDL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |