5-aminopyridine-2,3-dicarboxylic acid

C7H6N2O4 — CID 71695342

IUPAC5-aminopyridine-2,3-dicarboxylic acid
SMILESNc1cnc(C(=O)O)c(C(=O)O)c1
InChIInChI=1S/C7H6N2O4/c8-3-1-4(6(10)11)5(7(12)13)9-2-3/h1-2H,8H2,(H,10,11)(H,12,13)
InChIKeyWVDZHPOUZQHFDL-UHFFFAOYSA-N
MW182.14 g/mol
LogP0.06
Rot. Bonds2

About 5-aminopyridine-2,3-dicarboxylic acid

5-aminopyridine-2,3-dicarboxylic acid (PubChem CID 71695342) has the molecular formula C7H6N2O4 and a molecular weight of 182.14 g/mol. Its IUPAC name is 5-aminopyridine-2,3-dicarboxylic acid.

Molecular Properties

Compound Name5-aminopyridine-2,3-dicarboxylic acid
PubChem CID71695342
Molecular FormulaC7H6N2O4
Molecular Weight182.14 g/mol
Exact Mass182.03
IUPAC Name5-aminopyridine-2,3-dicarboxylic acid
SMILESNc1cnc(C(=O)O)c(C(=O)O)c1
InChIInChI=1S/C7H6N2O4/c8-3-1-4(6(10)11)5(7(12)13)9-2-3/h1-2H,8H2,(H,10,11)(H,12,13)
InChIKeyWVDZHPOUZQHFDL-UHFFFAOYSA-N
XLogP0.06
TPSA113.51 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.14
LogP ≤ 50.06
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 5-aminopyridine-2,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-aminopyridine-2,3-dicarboxylic acid?
The IUPAC name of 5-aminopyridine-2,3-dicarboxylic acid (CID 71695342) is 5-aminopyridine-2,3-dicarboxylic acid.
What is the SMILES notation for 5-aminopyridine-2,3-dicarboxylic acid?
The canonical SMILES for 5-aminopyridine-2,3-dicarboxylic acid is Nc1cnc(C(=O)O)c(C(=O)O)c1.
What is the InChIKey of 5-aminopyridine-2,3-dicarboxylic acid?
The InChIKey is WVDZHPOUZQHFDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O4/c8-3-1-4(6(10)11)5(7(12)13)9-2-3/h1-2H,8H2,(H,10,11)(H,12,13).
What are the key properties of 5-aminopyridine-2,3-dicarboxylic acid?
5-aminopyridine-2,3-dicarboxylic acid has a molecular weight of 182.14 g/mol, XLogP of 0.06, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopyridine-2,3-dicarboxylic acid is sourced from PubChem (CID 71695342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).