C9H8ClNO4 — CID 19010337
5-(2-chloroethyl)pyridine-2,3-dicarboxylic acid (PubChem CID 19010337) has the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. Its IUPAC name is 5-(2-chloroethyl)pyridine-2,3-dicarboxylic acid.
| Compound Name | 5-(2-chloroethyl)pyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 19010337 |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 5-(2-chloroethyl)pyridine-2,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(CCCl)cnc1C(=O)O |
| InChI | InChI=1S/C9H8ClNO4/c10-2-1-5-3-6(8(12)13)7(9(14)15)11-4-5/h3-4H,1-2H2,(H,12,13)(H,14,15) |
| InChIKey | KTUVCTRXARADCT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|