C11H14N2O4S — CID 121267301
5-[2-(2-aminoethylsulfanyl)ethyl]pyridine-2,3-dicarboxylic acid (PubChem CID 121267301) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 5-[2-(2-aminoethylsulfanyl)ethyl]pyridine-2,3-dicarboxylic acid.
| Compound Name | 5-[2-(2-aminoethylsulfanyl)ethyl]pyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 121267301 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-[2-(2-aminoethylsulfanyl)ethyl]pyridine-2,3-dicarboxylic acid |
| SMILES | NCCSCCc1cnc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H14N2O4S/c12-2-4-18-3-1-7-5-8(10(14)15)9(11(16)17)13-6-7/h5-6H,1-4,12H2,(H,14,15)(H,16,17) |
| InChIKey | WLVOOFNTQNLADR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|