C8H11ClN2O2S — CID 70452935
2-(2-aminoethylsulfanyl)pyridine-3-carboxylic acid;hydrochloride (PubChem CID 70452935) has the molecular formula C8H11ClN2O2S and a molecular weight of 234.71 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)pyridine-3-carboxylic acid;hydrochloride.
| Compound Name | 2-(2-aminoethylsulfanyl)pyridine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70452935 |
| Molecular Formula | C8H11ClN2O2S |
| Molecular Weight | 234.71 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)pyridine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.NCCSc1ncccc1C(=O)O |
| InChI | InChI=1S/C8H10N2O2S.ClH/c9-3-5-13-7-6(8(11)12)2-1-4-10-7;/h1-2,4H,3,5,9H2,(H,11,12);1H |
| InChIKey | SJSPWWOSURQWJQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.71 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |