C13H19N3O2S — CID 82889436
2-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 82889436) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 82889436 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-[2-(4-methylpiperazin-1-yl)ethylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | CN1CCN(CCSc2ncccc2C(=O)O)CC1 |
| InChI | InChI=1S/C13H19N3O2S/c1-15-5-7-16(8-6-15)9-10-19-12-11(13(17)18)3-2-4-14-12/h2-4H,5-10H2,1H3,(H,17,18) |
| InChIKey | NKOGBXLZBPXBTO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |