C8H8FNO2S — CID 80700083
2-(2-fluoroethylsulfanyl)pyridine-3-carboxylic acid (PubChem CID 80700083) has the molecular formula C8H8FNO2S and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(2-fluoroethylsulfanyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(2-fluoroethylsulfanyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 80700083 |
| Molecular Formula | C8H8FNO2S |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | 2-(2-fluoroethylsulfanyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SCCF |
| InChI | InChI=1S/C8H8FNO2S/c9-3-5-13-7-6(8(11)12)2-1-4-10-7/h1-2,4H,3,5H2,(H,11,12) |
| InChIKey | ASXUZXRPRXNYEU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |