C9H7F4NO2S — CID 46398493
2-(2,2,3,3-tetrafluoropropylsulfanyl)pyridine-3-carboxylic acid (PubChem CID 46398493) has the molecular formula C9H7F4NO2S and a molecular weight of 269.22 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropylsulfanyl)pyridine-3-carboxylic acid.
| Compound Name | 2-(2,2,3,3-tetrafluoropropylsulfanyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 46398493 |
| Molecular Formula | C9H7F4NO2S |
| Molecular Weight | 269.22 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropylsulfanyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H7F4NO2S/c10-8(11)9(12,13)4-17-6-5(7(15)16)2-1-3-14-6/h1-3,8H,4H2,(H,15,16) |
| InChIKey | DVQABGISCKXLTA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|