C14H11F2NO3S — CID 43352306
2-[[2-(difluoromethoxy)phenyl]methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 43352306) has the molecular formula C14H11F2NO3S and a molecular weight of 311.31 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 43352306 |
| Molecular Formula | C14H11F2NO3S |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1SCc1ccccc1OC(F)F |
| InChI | InChI=1S/C14H11F2NO3S/c15-14(16)20-11-6-2-1-4-9(11)8-21-12-10(13(18)19)5-3-7-17-12/h1-7,14H,8H2,(H,18,19) |
| InChIKey | JRYXAZVUJJDSSB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |